C27H22FN3O3 — CID 90516055
N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-(4-methylbenzoyl)benzamide (PubChem CID 90516055) has the molecular formula C27H22FN3O3 and a molecular weight of 455.49 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-(4-methylbenzoyl)benzamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-(4-methylbenzoyl)benzamide |
|---|---|
| PubChem CID | 90516055 |
| Molecular Formula | C27H22FN3O3 |
| Molecular Weight | 455.49 g/mol |
| Exact Mass | 455.16 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-2-(4-methylbenzoyl)benzamide |
| SMILES | Cc1ccc(C(=O)c2ccccc2C(=O)NCCn2cnc(-c3ccc(F)cc3)cc2=O)cc1 |
| InChI | InChI=1S/C27H22FN3O3/c1-18-6-8-20(9-7-18)26(33)22-4-2-3-5-23(22)27(34)29-14-15-31-17-30-24(16-25(31)32)19-10-12-21(28)13-11-19/h2-13,16-17H,14-15H2,1H3,(H,29,34) |
| InChIKey | AIHJKKQOEBRAJY-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 81.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.49 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |