C20H17FN4O4 — CID 90516264
N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-3-methyl-4-nitrobenzamide (PubChem CID 90516264) has the molecular formula C20H17FN4O4 and a molecular weight of 396.38 g/mol. Its IUPAC name is N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-3-methyl-4-nitrobenzamide.
| Compound Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-3-methyl-4-nitrobenzamide |
|---|---|
| PubChem CID | 90516264 |
| Molecular Formula | C20H17FN4O4 |
| Molecular Weight | 396.38 g/mol |
| Exact Mass | 396.12 |
| IUPAC Name | N-[2-[4-(4-fluorophenyl)-6-oxopyrimidin-1-yl]ethyl]-3-methyl-4-nitrobenzamide |
| SMILES | Cc1cc(C(=O)NCCn2cnc(-c3ccc(F)cc3)cc2=O)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H17FN4O4/c1-13-10-15(4-7-18(13)25(28)29)20(27)22-8-9-24-12-23-17(11-19(24)26)14-2-5-16(21)6-3-14/h2-7,10-12H,8-9H2,1H3,(H,22,27) |
| InChIKey | HSEDKHNPMIIEGB-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 107.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.38 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|