C21H20N4O5 — CID 90515756
N-[2-[4-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]-4-methyl-3-nitrobenzamide (PubChem CID 90515756) has the molecular formula C21H20N4O5 and a molecular weight of 408.41 g/mol. Its IUPAC name is N-[2-[4-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]-4-methyl-3-nitrobenzamide.
| Compound Name | N-[2-[4-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]-4-methyl-3-nitrobenzamide |
|---|---|
| PubChem CID | 90515756 |
| Molecular Formula | C21H20N4O5 |
| Molecular Weight | 408.41 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | N-[2-[4-(4-methoxyphenyl)-6-oxopyrimidin-1-yl]ethyl]-4-methyl-3-nitrobenzamide |
| SMILES | COc1ccc(-c2cc(=O)n(CCNC(=O)c3ccc(C)c([N+](=O)[O-])c3)cn2)cc1 |
| InChI | InChI=1S/C21H20N4O5/c1-14-3-4-16(11-19(14)25(28)29)21(27)22-9-10-24-13-23-18(12-20(24)26)15-5-7-17(30-2)8-6-15/h3-8,11-13H,9-10H2,1-2H3,(H,22,27) |
| InChIKey | JWWQVQCYFULHJC-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.41 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|