C21H15FN4O5 — CID 17083937
3-(4-fluorophenyl)-N-[2-[(2-oxochromene-3-carbonyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083937) has the molecular formula C21H15FN4O5 and a molecular weight of 422.37 g/mol. Its IUPAC name is 3-(4-fluorophenyl)-N-[2-[(2-oxochromene-3-carbonyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(4-fluorophenyl)-N-[2-[(2-oxochromene-3-carbonyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083937 |
| Molecular Formula | C21H15FN4O5 |
| Molecular Weight | 422.37 g/mol |
| Exact Mass | 422.10 |
| IUPAC Name | 3-(4-fluorophenyl)-N-[2-[(2-oxochromene-3-carbonyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1cc2ccccc2oc1=O)c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C21H15FN4O5/c22-14-7-5-12(6-8-14)17-25-20(31-26-17)19(28)24-10-9-23-18(27)15-11-13-3-1-2-4-16(13)30-21(15)29/h1-8,11H,9-10H2,(H,23,27)(H,24,28) |
| InChIKey | WJCNHFZZJGZXTN-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 127.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.37 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|