C25H21FN4O3 — CID 17083936
N-[2-[(2,2-diphenylacetyl)amino]ethyl]-3-(4-fluorophenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083936) has the molecular formula C25H21FN4O3 and a molecular weight of 444.47 g/mol. Its IUPAC name is N-[2-[(2,2-diphenylacetyl)amino]ethyl]-3-(4-fluorophenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(2,2-diphenylacetyl)amino]ethyl]-3-(4-fluorophenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083936 |
| Molecular Formula | C25H21FN4O3 |
| Molecular Weight | 444.47 g/mol |
| Exact Mass | 444.16 |
| IUPAC Name | N-[2-[(2,2-diphenylacetyl)amino]ethyl]-3-(4-fluorophenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)C(c1ccccc1)c1ccccc1)c1nc(-c2ccc(F)cc2)no1 |
| InChI | InChI=1S/C25H21FN4O3/c26-20-13-11-19(12-14-20)22-29-25(33-30-22)24(32)28-16-15-27-23(31)21(17-7-3-1-4-8-17)18-9-5-2-6-10-18/h1-14,21H,15-16H2,(H,27,31)(H,28,32) |
| InChIKey | RGTHWONUOBKICG-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|