C19H16F2N4O4 — CID 17084206
N-[2-[(2,6-difluorobenzoyl)amino]ethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17084206) has the molecular formula C19H16F2N4O4 and a molecular weight of 402.36 g/mol. Its IUPAC name is N-[2-[(2,6-difluorobenzoyl)amino]ethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(2,6-difluorobenzoyl)amino]ethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17084206 |
| Molecular Formula | C19H16F2N4O4 |
| Molecular Weight | 402.36 g/mol |
| Exact Mass | 402.11 |
| IUPAC Name | N-[2-[(2,6-difluorobenzoyl)amino]ethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(-c2noc(C(=O)NCCNC(=O)c3c(F)cccc3F)n2)cc1 |
| InChI | InChI=1S/C19H16F2N4O4/c1-28-12-7-5-11(6-8-12)16-24-19(29-25-16)18(27)23-10-9-22-17(26)15-13(20)3-2-4-14(15)21/h2-8H,9-10H2,1H3,(H,22,26)(H,23,27) |
| InChIKey | IRDDJMMAAKQLHY-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 106.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.36 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|