C18H14Cl2N4O3 — CID 17083223
N-[2-[(3-chlorobenzoyl)amino]ethyl]-3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083223) has the molecular formula C18H14Cl2N4O3 and a molecular weight of 405.24 g/mol. Its IUPAC name is N-[2-[(3-chlorobenzoyl)amino]ethyl]-3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(3-chlorobenzoyl)amino]ethyl]-3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083223 |
| Molecular Formula | C18H14Cl2N4O3 |
| Molecular Weight | 405.24 g/mol |
| Exact Mass | 404.04 |
| IUPAC Name | N-[2-[(3-chlorobenzoyl)amino]ethyl]-3-(4-chlorophenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | O=C(NCCNC(=O)c1nc(-c2ccc(Cl)cc2)no1)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H14Cl2N4O3/c19-13-6-4-11(5-7-13)15-23-18(27-24-15)17(26)22-9-8-21-16(25)12-2-1-3-14(20)10-12/h1-7,10H,8-9H2,(H,21,25)(H,22,26) |
| InChIKey | MIYMTUQQYALTSP-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 97.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.24 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|