C21H22N4O6 — CID 16765831
N-[2-[(3,4-dimethoxybenzoyl)amino]ethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide (PubChem CID 16765831) has the molecular formula C21H22N4O6 and a molecular weight of 426.43 g/mol. Its IUPAC name is N-[2-[(3,4-dimethoxybenzoyl)amino]ethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | N-[2-[(3,4-dimethoxybenzoyl)amino]ethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 16765831 |
| Molecular Formula | C21H22N4O6 |
| Molecular Weight | 426.43 g/mol |
| Exact Mass | 426.15 |
| IUPAC Name | N-[2-[(3,4-dimethoxybenzoyl)amino]ethyl]-3-(4-methoxyphenyl)-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(-c2noc(C(=O)NCCNC(=O)c3ccc(OC)c(OC)c3)n2)cc1 |
| InChI | InChI=1S/C21H22N4O6/c1-28-15-7-4-13(5-8-15)18-24-21(31-25-18)20(27)23-11-10-22-19(26)14-6-9-16(29-2)17(12-14)30-3/h4-9,12H,10-11H2,1-3H3,(H,22,26)(H,23,27) |
| InChIKey | KRUVINJOLBSWRB-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 124.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|