C22H22N4O8 — CID 17083346
3-(1,3-benzodioxol-5-yl)-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083346) has the molecular formula C22H22N4O8 and a molecular weight of 470.44 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-yl)-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083346 |
| Molecular Formula | C22H22N4O8 |
| Molecular Weight | 470.44 g/mol |
| Exact Mass | 470.14 |
| IUPAC Name | 3-(1,3-benzodioxol-5-yl)-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1cc(C(=O)NCCNC(=O)c2nc(-c3ccc4c(c3)OCO4)no2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N4O8/c1-29-16-9-13(10-17(30-2)18(16)31-3)20(27)23-6-7-24-21(28)22-25-19(26-34-22)12-4-5-14-15(8-12)33-11-32-14/h4-5,8-10H,6-7,11H2,1-3H3,(H,23,27)(H,24,28) |
| InChIKey | AJTHWPFFTPZBPC-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.44 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|