C23H26N4O8 — CID 17083952
3-(3,4-dimethoxyphenyl)-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide (PubChem CID 17083952) has the molecular formula C23H26N4O8 and a molecular weight of 486.48 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide.
| Compound Name | 3-(3,4-dimethoxyphenyl)-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
|---|---|
| PubChem CID | 17083952 |
| Molecular Formula | C23H26N4O8 |
| Molecular Weight | 486.48 g/mol |
| Exact Mass | 486.18 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-N-[2-[(3,4,5-trimethoxybenzoyl)amino]ethyl]-1,2,4-oxadiazole-5-carboxamide |
| SMILES | COc1ccc(-c2noc(C(=O)NCCNC(=O)c3cc(OC)c(OC)c(OC)c3)n2)cc1OC |
| InChI | InChI=1S/C23H26N4O8/c1-30-15-7-6-13(10-16(15)31-2)20-26-23(35-27-20)22(29)25-9-8-24-21(28)14-11-17(32-3)19(34-5)18(12-14)33-4/h6-7,10-12H,8-9H2,1-5H3,(H,24,28)(H,25,29) |
| InChIKey | YHCPFSKQKCENAI-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 143.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.48 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|