C19H15F2NO4 — CID 51201859
N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-oxochromene-3-carboxamide (PubChem CID 51201859) has the molecular formula C19H15F2NO4 and a molecular weight of 359.33 g/mol. Its IUPAC name is N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-oxochromene-3-carboxamide.
| Compound Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 51201859 |
| Molecular Formula | C19H15F2NO4 |
| Molecular Weight | 359.33 g/mol |
| Exact Mass | 359.10 |
| IUPAC Name | N-[2-[4-(difluoromethoxy)phenyl]ethyl]-2-oxochromene-3-carboxamide |
| SMILES | O=C(NCCc1ccc(OC(F)F)cc1)c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C19H15F2NO4/c20-19(21)25-14-7-5-12(6-8-14)9-10-22-17(23)15-11-13-3-1-2-4-16(13)26-18(15)24/h1-8,11,19H,9-10H2,(H,22,23) |
| InChIKey | YIIVJIBVWNQCTD-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.33 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|