C21H19Cl3N2O4 — CID 18884970
2-oxo-N-[2,2,2-trichloro-1-[2-(4-methoxyphenyl)ethylamino]ethyl]chromene-3-carboxamide (PubChem CID 18884970) has the molecular formula C21H19Cl3N2O4 and a molecular weight of 469.75 g/mol. Its IUPAC name is 2-oxo-N-[2,2,2-trichloro-1-[2-(4-methoxyphenyl)ethylamino]ethyl]chromene-3-carboxamide.
| Compound Name | 2-oxo-N-[2,2,2-trichloro-1-[2-(4-methoxyphenyl)ethylamino]ethyl]chromene-3-carboxamide |
|---|---|
| PubChem CID | 18884970 |
| Molecular Formula | C21H19Cl3N2O4 |
| Molecular Weight | 469.75 g/mol |
| Exact Mass | 468.04 |
| IUPAC Name | 2-oxo-N-[2,2,2-trichloro-1-[2-(4-methoxyphenyl)ethylamino]ethyl]chromene-3-carboxamide |
| SMILES | COc1ccc(CCNC(NC(=O)c2cc3ccccc3oc2=O)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C21H19Cl3N2O4/c1-29-15-8-6-13(7-9-15)10-11-25-20(21(22,23)24)26-18(27)16-12-14-4-2-3-5-17(14)30-19(16)28/h2-9,12,20,25H,10-11H2,1H3,(H,26,27) |
| InChIKey | BLHKPRVFTBKLCM-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.75 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|