C14H13NO6 — CID 81084500
3-methoxy-2-[(2-oxochromene-3-carbonyl)amino]propanoic acid (PubChem CID 81084500) has the molecular formula C14H13NO6 and a molecular weight of 291.26 g/mol. Its IUPAC name is 3-methoxy-2-[(2-oxochromene-3-carbonyl)amino]propanoic acid.
| Compound Name | 3-methoxy-2-[(2-oxochromene-3-carbonyl)amino]propanoic acid |
|---|---|
| PubChem CID | 81084500 |
| Molecular Formula | C14H13NO6 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.07 |
| IUPAC Name | 3-methoxy-2-[(2-oxochromene-3-carbonyl)amino]propanoic acid |
| SMILES | COCC(NC(=O)c1cc2ccccc2oc1=O)C(=O)O |
| InChI | InChI=1S/C14H13NO6/c1-20-7-10(13(17)18)15-12(16)9-6-8-4-2-3-5-11(8)21-14(9)19/h2-6,10H,7H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | RWOJNQSUOFTTPB-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 105.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|