C14H13NO5 — CID 43469616
2-[(2-oxochromene-3-carbonyl)amino]butanoic acid (PubChem CID 43469616) has the molecular formula C14H13NO5 and a molecular weight of 275.26 g/mol. Its IUPAC name is 2-[(2-oxochromene-3-carbonyl)amino]butanoic acid.
| Compound Name | 2-[(2-oxochromene-3-carbonyl)amino]butanoic acid |
|---|---|
| PubChem CID | 43469616 |
| Molecular Formula | C14H13NO5 |
| Molecular Weight | 275.26 g/mol |
| Exact Mass | 275.08 |
| IUPAC Name | 2-[(2-oxochromene-3-carbonyl)amino]butanoic acid |
| SMILES | CCC(NC(=O)c1cc2ccccc2oc1=O)C(=O)O |
| InChI | InChI=1S/C14H13NO5/c1-2-10(13(17)18)15-12(16)9-7-8-5-3-4-6-11(8)20-14(9)19/h3-7,10H,2H2,1H3,(H,15,16)(H,17,18) |
| InChIKey | DZCAPLQPHBGYKE-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 96.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.26 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|