C14H11NO8 — CID 20823648
2-[(7-methoxy-2-oxochromene-3-carbonyl)amino]propanedioic acid (PubChem CID 20823648) has the molecular formula C14H11NO8 and a molecular weight of 321.24 g/mol. Its IUPAC name is 2-[(7-methoxy-2-oxochromene-3-carbonyl)amino]propanedioic acid.
| Compound Name | 2-[(7-methoxy-2-oxochromene-3-carbonyl)amino]propanedioic acid |
|---|---|
| PubChem CID | 20823648 |
| Molecular Formula | C14H11NO8 |
| Molecular Weight | 321.24 g/mol |
| Exact Mass | 321.05 |
| IUPAC Name | 2-[(7-methoxy-2-oxochromene-3-carbonyl)amino]propanedioic acid |
| SMILES | COc1ccc2cc(C(=O)NC(C(=O)O)C(=O)O)c(=O)oc2c1 |
| InChI | InChI=1S/C14H11NO8/c1-22-7-3-2-6-4-8(14(21)23-9(6)5-7)11(16)15-10(12(17)18)13(19)20/h2-5,10H,1H3,(H,15,16)(H,17,18)(H,19,20) |
| InChIKey | YBKWDXLXPYGSDA-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 143.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.24 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|