C16H19NO4 — CID 133184087
6-methoxy-2-oxo-N-pentan-2-ylchromene-3-carboxamide (PubChem CID 133184087) has the molecular formula C16H19NO4 and a molecular weight of 289.33 g/mol. Its IUPAC name is 6-methoxy-2-oxo-N-pentan-2-ylchromene-3-carboxamide.
| Compound Name | 6-methoxy-2-oxo-N-pentan-2-ylchromene-3-carboxamide |
|---|---|
| PubChem CID | 133184087 |
| Molecular Formula | C16H19NO4 |
| Molecular Weight | 289.33 g/mol |
| Exact Mass | 289.13 |
| IUPAC Name | 6-methoxy-2-oxo-N-pentan-2-ylchromene-3-carboxamide |
| SMILES | CCCC(C)NC(=O)c1cc2cc(OC)ccc2oc1=O |
| InChI | InChI=1S/C16H19NO4/c1-4-5-10(2)17-15(18)13-9-11-8-12(20-3)6-7-14(11)21-16(13)19/h6-10H,4-5H2,1-3H3,(H,17,18) |
| InChIKey | ZDDFBBQTRURQNO-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.33 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|