C15H17NO5 — CID 2148152
6-methoxy-N-(3-methoxypropyl)-2-oxochromene-3-carboxamide (PubChem CID 2148152) has the molecular formula C15H17NO5 and a molecular weight of 291.30 g/mol. Its IUPAC name is 6-methoxy-N-(3-methoxypropyl)-2-oxochromene-3-carboxamide.
| Compound Name | 6-methoxy-N-(3-methoxypropyl)-2-oxochromene-3-carboxamide |
|---|---|
| PubChem CID | 2148152 |
| Molecular Formula | C15H17NO5 |
| Molecular Weight | 291.30 g/mol |
| Exact Mass | 291.11 |
| IUPAC Name | 6-methoxy-N-(3-methoxypropyl)-2-oxochromene-3-carboxamide |
| SMILES | COCCCNC(=O)c1cc2cc(OC)ccc2oc1=O |
| InChI | InChI=1S/C15H17NO5/c1-19-7-3-6-16-14(17)12-9-10-8-11(20-2)4-5-13(10)21-15(12)18/h4-5,8-9H,3,6-7H2,1-2H3,(H,16,17) |
| InChIKey | AJWUTLMXIYMEET-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 77.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.30 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|