C25H25NO8 — CID 19186217
[3-(3-methoxypropylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate (PubChem CID 19186217) has the molecular formula C25H25NO8 and a molecular weight of 467.47 g/mol. Its IUPAC name is [3-(3-methoxypropylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate.
| Compound Name | [3-(3-methoxypropylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19186217 |
| Molecular Formula | C25H25NO8 |
| Molecular Weight | 467.47 g/mol |
| Exact Mass | 467.16 |
| IUPAC Name | [3-(3-methoxypropylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3,4-dimethoxyphenyl)prop-2-enoate |
| SMILES | COCCCNC(=O)c1cc2ccc(OC(=O)/C=C/c3ccc(OC)c(OC)c3)cc2oc1=O |
| InChI | InChI=1S/C25H25NO8/c1-30-12-4-11-26-24(28)19-14-17-7-8-18(15-21(17)34-25(19)29)33-23(27)10-6-16-5-9-20(31-2)22(13-16)32-3/h5-10,13-15H,4,11-12H2,1-3H3,(H,26,28)/b10-6+ |
| InChIKey | OIVDFQHEHUGWIY-UXBLZVDNSA-N |
| XLogP | 3.20 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.47 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|