C28H25NO8 — CID 19185233
[3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate (PubChem CID 19185233) has the molecular formula C28H25NO8 and a molecular weight of 503.51 g/mol. Its IUPAC name is [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate.
| Compound Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19185233 |
| Molecular Formula | C28H25NO8 |
| Molecular Weight | 503.51 g/mol |
| Exact Mass | 503.16 |
| IUPAC Name | [3-(furan-2-ylmethylcarbamoyl)-2-oxochromen-7-yl] (E)-3-(3-methoxy-4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)Oc2ccc3cc(C(=O)NCc4ccco4)c(=O)oc3c2)cc1OC |
| InChI | InChI=1S/C28H25NO8/c1-3-12-35-23-10-6-18(14-25(23)33-2)7-11-26(30)36-20-9-8-19-15-22(28(32)37-24(19)16-20)27(31)29-17-21-5-4-13-34-21/h4-11,13-16H,3,12,17H2,1-2H3,(H,29,31)/b11-7+ |
| InChIKey | YVBGKSIMUQDFPY-YRNVUSSQSA-N |
| XLogP | 4.73 |
| TPSA | 117.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.51 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|