C35H29NO7 — CID 19186408
[2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate (PubChem CID 19186408) has the molecular formula C35H29NO7 and a molecular weight of 575.62 g/mol. Its IUPAC name is [2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate.
| Compound Name | [2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 19186408 |
| Molecular Formula | C35H29NO7 |
| Molecular Weight | 575.62 g/mol |
| Exact Mass | 575.19 |
| IUPAC Name | [2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] (E)-3-(3-methoxy-4-phenylmethoxyphenyl)prop-2-enoate |
| SMILES | COc1cc(/C=C/C(=O)Oc2ccc3cc(C(=O)NC(C)c4ccccc4)c(=O)oc3c2)ccc1OCc1ccccc1 |
| InChI | InChI=1S/C35H29NO7/c1-23(26-11-7-4-8-12-26)36-34(38)29-20-27-15-16-28(21-31(27)43-35(29)39)42-33(37)18-14-24-13-17-30(32(19-24)40-2)41-22-25-9-5-3-6-10-25/h3-21,23H,22H2,1-2H3,(H,36,38)/b18-14+ |
| InChIKey | FHWRJYKQEVNPNS-NBVRZTHBSA-N |
| XLogP | 6.49 |
| TPSA | 104.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.62 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|