C31H31NO8 — CID 19186177
[2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] 3,4,5-triethoxybenzoate (PubChem CID 19186177) has the molecular formula C31H31NO8 and a molecular weight of 545.59 g/mol. Its IUPAC name is [2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] 3,4,5-triethoxybenzoate.
| Compound Name | [2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] 3,4,5-triethoxybenzoate |
|---|---|
| PubChem CID | 19186177 |
| Molecular Formula | C31H31NO8 |
| Molecular Weight | 545.59 g/mol |
| Exact Mass | 545.20 |
| IUPAC Name | [2-oxo-3-(1-phenylethylcarbamoyl)chromen-7-yl] 3,4,5-triethoxybenzoate |
| SMILES | CCOc1cc(C(=O)Oc2ccc3cc(C(=O)NC(C)c4ccccc4)c(=O)oc3c2)cc(OCC)c1OCC |
| InChI | InChI=1S/C31H31NO8/c1-5-36-26-16-22(17-27(37-6-2)28(26)38-7-3)30(34)39-23-14-13-21-15-24(31(35)40-25(21)18-23)29(33)32-19(4)20-11-9-8-10-12-20/h8-19H,5-7H2,1-4H3,(H,32,33) |
| InChIKey | WUUBCWIMHRQIHU-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 113.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.59 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|