C23H24N2O7 — CID 34250417
2-oxo-N'-(3,4,5-triethoxybenzoyl)chromene-3-carbohydrazide (PubChem CID 34250417) has the molecular formula C23H24N2O7 and a molecular weight of 440.45 g/mol. Its IUPAC name is 2-oxo-N'-(3,4,5-triethoxybenzoyl)chromene-3-carbohydrazide.
| Compound Name | 2-oxo-N'-(3,4,5-triethoxybenzoyl)chromene-3-carbohydrazide |
|---|---|
| PubChem CID | 34250417 |
| Molecular Formula | C23H24N2O7 |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.16 |
| IUPAC Name | 2-oxo-N'-(3,4,5-triethoxybenzoyl)chromene-3-carbohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2cc3ccccc3oc2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H24N2O7/c1-4-29-18-12-15(13-19(30-5-2)20(18)31-6-3)21(26)24-25-22(27)16-11-14-9-7-8-10-17(14)32-23(16)28/h7-13H,4-6H2,1-3H3,(H,24,26)(H,25,27) |
| InChIKey | LZFIAXHSKFPKIU-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|