C23H25N3O6 — CID 55602361
4-oxo-N'-(3,4,5-triethoxybenzoyl)-1H-quinoline-3-carbohydrazide (PubChem CID 55602361) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is 4-oxo-N'-(3,4,5-triethoxybenzoyl)-1H-quinoline-3-carbohydrazide.
| Compound Name | 4-oxo-N'-(3,4,5-triethoxybenzoyl)-1H-quinoline-3-carbohydrazide |
|---|---|
| PubChem CID | 55602361 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | 4-oxo-N'-(3,4,5-triethoxybenzoyl)-1H-quinoline-3-carbohydrazide |
| SMILES | CCOc1cc(C(=O)NNC(=O)c2c[nH]c3ccccc3c2=O)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H25N3O6/c1-4-30-18-11-14(12-19(31-5-2)21(18)32-6-3)22(28)25-26-23(29)16-13-24-17-10-8-7-9-15(17)20(16)27/h7-13H,4-6H2,1-3H3,(H,24,27)(H,25,28)(H,26,29) |
| InChIKey | NWUQBOFVXCPEGN-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 118.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|