C23H28N2O4 — CID 27645186
3,4,5-triethoxy-N-[2-(1H-indol-3-yl)ethyl]benzamide (PubChem CID 27645186) has the molecular formula C23H28N2O4 and a molecular weight of 396.49 g/mol. Its IUPAC name is 3,4,5-triethoxy-N-[2-(1H-indol-3-yl)ethyl]benzamide.
| Compound Name | 3,4,5-triethoxy-N-[2-(1H-indol-3-yl)ethyl]benzamide |
|---|---|
| PubChem CID | 27645186 |
| Molecular Formula | C23H28N2O4 |
| Molecular Weight | 396.49 g/mol |
| Exact Mass | 396.20 |
| IUPAC Name | 3,4,5-triethoxy-N-[2-(1H-indol-3-yl)ethyl]benzamide |
| SMILES | CCOc1cc(C(=O)NCCc2c[nH]c3ccccc23)cc(OCC)c1OCC |
| InChI | InChI=1S/C23H28N2O4/c1-4-27-20-13-17(14-21(28-5-2)22(20)29-6-3)23(26)24-12-11-16-15-25-19-10-8-7-9-18(16)19/h7-10,13-15,25H,4-6,11-12H2,1-3H3,(H,24,26) |
| InChIKey | SRPFQBCJTVNZEQ-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |