C22H25N3O2 — CID 109055657
3-N,3-N-diethyl-1-N-[2-(1H-indol-3-yl)ethyl]benzene-1,3-dicarboxamide (PubChem CID 109055657) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is 3-N,3-N-diethyl-1-N-[2-(1H-indol-3-yl)ethyl]benzene-1,3-dicarboxamide.
| Compound Name | 3-N,3-N-diethyl-1-N-[2-(1H-indol-3-yl)ethyl]benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055657 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | 3-N,3-N-diethyl-1-N-[2-(1H-indol-3-yl)ethyl]benzene-1,3-dicarboxamide |
| SMILES | CCN(CC)C(=O)c1cccc(C(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C22H25N3O2/c1-3-25(4-2)22(27)17-9-7-8-16(14-17)21(26)23-13-12-18-15-24-20-11-6-5-10-19(18)20/h5-11,14-15,24H,3-4,12-13H2,1-2H3,(H,23,26) |
| InChIKey | NJKXDJMVMKTZQA-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 65.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |