C21H21N3O2 — CID 109050911
1-N-[2-(1H-indol-3-yl)ethyl]-3-N-prop-2-enylbenzene-1,3-dicarboxamide (PubChem CID 109050911) has the molecular formula C21H21N3O2 and a molecular weight of 347.42 g/mol. Its IUPAC name is 1-N-[2-(1H-indol-3-yl)ethyl]-3-N-prop-2-enylbenzene-1,3-dicarboxamide.
| Compound Name | 1-N-[2-(1H-indol-3-yl)ethyl]-3-N-prop-2-enylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109050911 |
| Molecular Formula | C21H21N3O2 |
| Molecular Weight | 347.42 g/mol |
| Exact Mass | 347.16 |
| IUPAC Name | 1-N-[2-(1H-indol-3-yl)ethyl]-3-N-prop-2-enylbenzene-1,3-dicarboxamide |
| SMILES | C=CCNC(=O)c1cccc(C(=O)NCCc2c[nH]c3ccccc23)c1 |
| InChI | InChI=1S/C21H21N3O2/c1-2-11-22-20(25)15-6-5-7-16(13-15)21(26)23-12-10-17-14-24-19-9-4-3-8-18(17)19/h2-9,13-14,24H,1,10-12H2,(H,22,25)(H,23,26) |
| InChIKey | UEQIGWCFVMBFDO-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.42 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|