C25H23N3O2 — CID 109055667
1-N-[2-(1H-indol-3-yl)ethyl]-3-N-(3-methylphenyl)benzene-1,3-dicarboxamide (PubChem CID 109055667) has the molecular formula C25H23N3O2 and a molecular weight of 397.48 g/mol. Its IUPAC name is 1-N-[2-(1H-indol-3-yl)ethyl]-3-N-(3-methylphenyl)benzene-1,3-dicarboxamide.
| Compound Name | 1-N-[2-(1H-indol-3-yl)ethyl]-3-N-(3-methylphenyl)benzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 109055667 |
| Molecular Formula | C25H23N3O2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.18 |
| IUPAC Name | 1-N-[2-(1H-indol-3-yl)ethyl]-3-N-(3-methylphenyl)benzene-1,3-dicarboxamide |
| SMILES | Cc1cccc(NC(=O)c2cccc(C(=O)NCCc3c[nH]c4ccccc34)c2)c1 |
| InChI | InChI=1S/C25H23N3O2/c1-17-6-4-9-21(14-17)28-25(30)19-8-5-7-18(15-19)24(29)26-13-12-20-16-27-23-11-3-2-10-22(20)23/h2-11,14-16,27H,12-13H2,1H3,(H,26,29)(H,28,30) |
| InChIKey | QKFYAFVJYNBGET-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 73.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |