C22H23N3O3 — CID 31941052
(2S)-N-[3-[2-(1H-indol-3-yl)ethylcarbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 31941052) has the molecular formula C22H23N3O3 and a molecular weight of 377.44 g/mol. Its IUPAC name is (2S)-N-[3-[2-(1H-indol-3-yl)ethylcarbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | (2S)-N-[3-[2-(1H-indol-3-yl)ethylcarbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 31941052 |
| Molecular Formula | C22H23N3O3 |
| Molecular Weight | 377.44 g/mol |
| Exact Mass | 377.17 |
| IUPAC Name | (2S)-N-[3-[2-(1H-indol-3-yl)ethylcarbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | O=C(NCCc1c[nH]c2ccccc12)c1cccc(NC(=O)[C@@H]2CCCO2)c1 |
| InChI | InChI=1S/C22H23N3O3/c26-21(23-11-10-16-14-24-19-8-2-1-7-18(16)19)15-5-3-6-17(13-15)25-22(27)20-9-4-12-28-20/h1-3,5-8,13-14,20,24H,4,9-12H2,(H,23,26)(H,25,27)/t20-/m0/s1 |
| InChIKey | UETQBGNRDIQPRK-FQEVSTJZSA-N |
| XLogP | 3.26 |
| TPSA | 83.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.44 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |