C30H32N4O3 — CID 43049716
N-[3-[[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]carbamoyl]phenyl]oxolane-2-carboxamide (PubChem CID 43049716) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is N-[3-[[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]carbamoyl]phenyl]oxolane-2-carboxamide.
| Compound Name | N-[3-[[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]carbamoyl]phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 43049716 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | N-[3-[[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]carbamoyl]phenyl]oxolane-2-carboxamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)c2cccc(NC(=O)C3CCCO3)c2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C30H32N4O3/c1-34(2)23-14-12-20(13-15-23)25(26-19-31-27-10-4-3-9-24(26)27)18-32-29(35)21-7-5-8-22(17-21)33-30(36)28-11-6-16-37-28/h3-5,7-10,12-15,17,19,25,28,31H,6,11,16,18H2,1-2H3,(H,32,35)(H,33,36) |
| InChIKey | VOYLKKOOPUUMKR-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 86.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|