C29H32N4O4S — CID 4831761
N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-morpholin-4-ylsulfonylbenzamide (PubChem CID 4831761) has the molecular formula C29H32N4O4S and a molecular weight of 532.67 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-morpholin-4-ylsulfonylbenzamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-morpholin-4-ylsulfonylbenzamide |
|---|---|
| PubChem CID | 4831761 |
| Molecular Formula | C29H32N4O4S |
| Molecular Weight | 532.67 g/mol |
| Exact Mass | 532.21 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-3-morpholin-4-ylsulfonylbenzamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)c2cccc(S(=O)(=O)N3CCOCC3)c2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C29H32N4O4S/c1-32(2)23-12-10-21(11-13-23)26(27-20-30-28-9-4-3-8-25(27)28)19-31-29(34)22-6-5-7-24(18-22)38(35,36)33-14-16-37-17-15-33/h3-13,18,20,26,30H,14-17,19H2,1-2H3,(H,31,34) |
| InChIKey | NJQVJUYVTLSJCZ-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 94.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.67 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|