C25H32N4O3S — CID 43053644
N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-1-methylsulfonylpiperidine-3-carboxamide (PubChem CID 43053644) has the molecular formula C25H32N4O3S and a molecular weight of 468.62 g/mol. Its IUPAC name is N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-1-methylsulfonylpiperidine-3-carboxamide.
| Compound Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-1-methylsulfonylpiperidine-3-carboxamide |
|---|---|
| PubChem CID | 43053644 |
| Molecular Formula | C25H32N4O3S |
| Molecular Weight | 468.62 g/mol |
| Exact Mass | 468.22 |
| IUPAC Name | N-[2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-1-methylsulfonylpiperidine-3-carboxamide |
| SMILES | CN(C)c1ccc(C(CNC(=O)C2CCCN(S(C)(=O)=O)C2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C25H32N4O3S/c1-28(2)20-12-10-18(11-13-20)22(23-16-26-24-9-5-4-8-21(23)24)15-27-25(30)19-7-6-14-29(17-19)33(3,31)32/h4-5,8-13,16,19,22,26H,6-7,14-15,17H2,1-3H3,(H,27,30) |
| InChIKey | IYSUTLACCUQDME-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 85.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.62 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|