C27H34N4O2 — CID 95781093
(2S)-2-cyclopropyl-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-morpholin-4-ylacetamide (PubChem CID 95781093) has the molecular formula C27H34N4O2 and a molecular weight of 446.60 g/mol. Its IUPAC name is (2S)-2-cyclopropyl-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-morpholin-4-ylacetamide.
| Compound Name | (2S)-2-cyclopropyl-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-morpholin-4-ylacetamide |
|---|---|
| PubChem CID | 95781093 |
| Molecular Formula | C27H34N4O2 |
| Molecular Weight | 446.60 g/mol |
| Exact Mass | 446.27 |
| IUPAC Name | (2S)-2-cyclopropyl-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]-2-morpholin-4-ylacetamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)[C@H](C2CC2)N2CCOCC2)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C27H34N4O2/c1-30(2)21-11-9-19(10-12-21)23(24-18-28-25-6-4-3-5-22(24)25)17-29-27(32)26(20-7-8-20)31-13-15-33-16-14-31/h3-6,9-12,18,20,23,26,28H,7-8,13-17H2,1-2H3,(H,29,32)/t23-,26-/m0/s1 |
| InChIKey | MDOHRWBLNHMQOL-OZXSUGGESA-N |
| XLogP | 3.59 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.60 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|