C28H29N3O3 — CID 41170413
2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]acetamide (PubChem CID 41170413) has the molecular formula C28H29N3O3 and a molecular weight of 455.56 g/mol. Its IUPAC name is 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]acetamide.
| Compound Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]acetamide |
|---|---|
| PubChem CID | 41170413 |
| Molecular Formula | C28H29N3O3 |
| Molecular Weight | 455.56 g/mol |
| Exact Mass | 455.22 |
| IUPAC Name | 2-(2,3-dihydro-1,4-benzodioxin-6-yl)-N-[(2S)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]acetamide |
| SMILES | CN(C)c1ccc([C@H](CNC(=O)Cc2ccc3c(c2)OCCO3)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C28H29N3O3/c1-31(2)21-10-8-20(9-11-21)23(24-18-29-25-6-4-3-5-22(24)25)17-30-28(32)16-19-7-12-26-27(15-19)34-14-13-33-26/h3-12,15,18,23,29H,13-14,16-17H2,1-2H3,(H,30,32)/t23-/m0/s1 |
| InChIKey | DFDDYPKEIQXSJC-QHCPKHFHSA-N |
| XLogP | 4.50 |
| TPSA | 66.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.56 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|