C28H30N4O3 — CID 41042249
(2S)-N-(1,3-benzodioxol-5-yl)-2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]amino]propanamide (PubChem CID 41042249) has the molecular formula C28H30N4O3 and a molecular weight of 470.57 g/mol. Its IUPAC name is (2S)-N-(1,3-benzodioxol-5-yl)-2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]amino]propanamide.
| Compound Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]amino]propanamide |
|---|---|
| PubChem CID | 41042249 |
| Molecular Formula | C28H30N4O3 |
| Molecular Weight | 470.57 g/mol |
| Exact Mass | 470.23 |
| IUPAC Name | (2S)-N-(1,3-benzodioxol-5-yl)-2-[[(2R)-2-[4-(dimethylamino)phenyl]-2-(1H-indol-3-yl)ethyl]amino]propanamide |
| SMILES | C[C@H](NC[C@H](c1ccc(N(C)C)cc1)c1c[nH]c2ccccc12)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H30N4O3/c1-18(28(33)31-20-10-13-26-27(14-20)35-17-34-26)29-15-23(19-8-11-21(12-9-19)32(2)3)24-16-30-25-7-5-4-6-22(24)25/h4-14,16,18,23,29-30H,15,17H2,1-3H3,(H,31,33)/t18-,23+/m0/s1 |
| InChIKey | AFFQVJARVUBEQL-FDDCHVKYSA-N |
| XLogP | 4.71 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.57 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_E(186)', 'substructure': 'N/A'} |
|---|