C23H20N2O2 — CID 134960682
4-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-N-methylaniline (PubChem CID 134960682) has the molecular formula C23H20N2O2 and a molecular weight of 356.43 g/mol. Its IUPAC name is 4-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-N-methylaniline.
| Compound Name | 4-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-N-methylaniline |
|---|---|
| PubChem CID | 134960682 |
| Molecular Formula | C23H20N2O2 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.15 |
| IUPAC Name | 4-[1,3-benzodioxol-5-yl(1H-indol-3-yl)methyl]-N-methylaniline |
| SMILES | CNc1ccc(C(c2ccc3c(c2)OCO3)c2c[nH]c3ccccc23)cc1 |
| InChI | InChI=1S/C23H20N2O2/c1-24-17-9-6-15(7-10-17)23(16-8-11-21-22(12-16)27-14-26-21)19-13-25-20-5-3-2-4-18(19)20/h2-13,23-25H,14H2,1H3 |
| InChIKey | ODRVWPPBDLMSIH-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |