C17H14N4O4 — CID 17270202
1-(1,3-benzodioxol-5-yl)-3-(1H-indole-3-carbonylamino)urea (PubChem CID 17270202) has the molecular formula C17H14N4O4 and a molecular weight of 338.32 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(1H-indole-3-carbonylamino)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(1H-indole-3-carbonylamino)urea |
|---|---|
| PubChem CID | 17270202 |
| Molecular Formula | C17H14N4O4 |
| Molecular Weight | 338.32 g/mol |
| Exact Mass | 338.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(1H-indole-3-carbonylamino)urea |
| SMILES | O=C(NNC(=O)c1c[nH]c2ccccc12)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C17H14N4O4/c22-16(12-8-18-13-4-2-1-3-11(12)13)20-21-17(23)19-10-5-6-14-15(7-10)25-9-24-14/h1-8,18H,9H2,(H,20,22)(H2,19,21,23) |
| InChIKey | VQDPKRMUZGHXMV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 104.48 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.32 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|