C17H13NO4 — CID 2989682
2-(1,3-benzodioxol-5-yloxy)-1-(1H-indol-3-yl)ethanone (PubChem CID 2989682) has the molecular formula C17H13NO4 and a molecular weight of 295.29 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-1-(1H-indol-3-yl)ethanone.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-1-(1H-indol-3-yl)ethanone |
|---|---|
| PubChem CID | 2989682 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-1-(1H-indol-3-yl)ethanone |
| SMILES | O=C(COc1ccc2c(c1)OCO2)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C17H13NO4/c19-15(13-8-18-14-4-2-1-3-12(13)14)9-20-11-5-6-16-17(7-11)22-10-21-16/h1-8,18H,9-10H2 |
| InChIKey | WRIZJPLTCGFMSL-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 60.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |