C16H11NO3 — CID 43161266
1,3-benzodioxol-5-yl(1H-indol-3-yl)methanone (PubChem CID 43161266) has the molecular formula C16H11NO3 and a molecular weight of 265.27 g/mol. Its IUPAC name is 1,3-benzodioxol-5-yl(1H-indol-3-yl)methanone.
| Compound Name | 1,3-benzodioxol-5-yl(1H-indol-3-yl)methanone |
|---|---|
| PubChem CID | 43161266 |
| Molecular Formula | C16H11NO3 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.07 |
| IUPAC Name | 1,3-benzodioxol-5-yl(1H-indol-3-yl)methanone |
| SMILES | O=C(c1ccc2c(c1)OCO2)c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H11NO3/c18-16(10-5-6-14-15(7-10)20-9-19-14)12-8-17-13-4-2-1-3-11(12)13/h1-8,17H,9H2 |
| InChIKey | JPEBKGPIVLFHHE-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |