C16H13N3O3 — CID 7616079
1-(1,3-benzodioxol-5-yl)-3-(1H-indol-3-yl)urea (PubChem CID 7616079) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(1H-indol-3-yl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(1H-indol-3-yl)urea |
|---|---|
| PubChem CID | 7616079 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(1H-indol-3-yl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)Nc1c[nH]c2ccccc12 |
| InChI | InChI=1S/C16H13N3O3/c20-16(18-10-5-6-14-15(7-10)22-9-21-14)19-13-8-17-12-4-2-1-3-11(12)13/h1-8,17H,9H2,(H2,18,19,20) |
| InChIKey | LCLQDSUQNGDYIO-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |