C14H10ClFN2O3 — CID 46860085
1-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-fluorophenyl)urea (PubChem CID 46860085) has the molecular formula C14H10ClFN2O3 and a molecular weight of 308.70 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-fluorophenyl)urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-fluorophenyl)urea |
|---|---|
| PubChem CID | 46860085 |
| Molecular Formula | C14H10ClFN2O3 |
| Molecular Weight | 308.70 g/mol |
| Exact Mass | 308.04 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-(5-chloro-2-fluorophenyl)urea |
| SMILES | O=C(Nc1ccc2c(c1)OCO2)Nc1cc(Cl)ccc1F |
| InChI | InChI=1S/C14H10ClFN2O3/c15-8-1-3-10(16)11(5-8)18-14(19)17-9-2-4-12-13(6-9)21-7-20-12/h1-6H,7H2,(H2,17,18,19) |
| InChIKey | HYERNAFITUMNMR-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.70 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |