C16H13ClFN3O4 — CID 2210538
1-(1,3-benzodioxol-5-yl)-3-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]urea (PubChem CID 2210538) has the molecular formula C16H13ClFN3O4 and a molecular weight of 365.75 g/mol. Its IUPAC name is 1-(1,3-benzodioxol-5-yl)-3-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]urea.
| Compound Name | 1-(1,3-benzodioxol-5-yl)-3-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]urea |
|---|---|
| PubChem CID | 2210538 |
| Molecular Formula | C16H13ClFN3O4 |
| Molecular Weight | 365.75 g/mol |
| Exact Mass | 365.06 |
| IUPAC Name | 1-(1,3-benzodioxol-5-yl)-3-[[2-(2-chloro-6-fluorophenyl)acetyl]amino]urea |
| SMILES | O=C(Cc1c(F)cccc1Cl)NNC(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H13ClFN3O4/c17-11-2-1-3-12(18)10(11)7-15(22)20-21-16(23)19-9-4-5-13-14(6-9)25-8-24-13/h1-6H,7-8H2,(H,20,22)(H2,19,21,23) |
| InChIKey | REGGQJMXLXZGCA-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 88.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.75 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|