C16H12F2N2O4 — CID 108956702
N-(1,3-benzodioxol-5-yl)-N'-(2,6-difluorophenyl)propanediamide (PubChem CID 108956702) has the molecular formula C16H12F2N2O4 and a molecular weight of 334.28 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-(2,6-difluorophenyl)propanediamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-(2,6-difluorophenyl)propanediamide |
|---|---|
| PubChem CID | 108956702 |
| Molecular Formula | C16H12F2N2O4 |
| Molecular Weight | 334.28 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-(2,6-difluorophenyl)propanediamide |
| SMILES | O=C(CC(=O)Nc1c(F)cccc1F)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C16H12F2N2O4/c17-10-2-1-3-11(18)16(10)20-15(22)7-14(21)19-9-4-5-12-13(6-9)24-8-23-12/h1-6H,7-8H2,(H,19,21)(H,20,22) |
| InChIKey | QKPNGTICUHWOPV-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.28 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|