C17H15FN2O4 — CID 113170871
2-(N-acetyl-2-fluoroanilino)-N-(1,3-benzodioxol-5-yl)acetamide (PubChem CID 113170871) has the molecular formula C17H15FN2O4 and a molecular weight of 330.32 g/mol. Its IUPAC name is 2-(N-acetyl-2-fluoroanilino)-N-(1,3-benzodioxol-5-yl)acetamide.
| Compound Name | 2-(N-acetyl-2-fluoroanilino)-N-(1,3-benzodioxol-5-yl)acetamide |
|---|---|
| PubChem CID | 113170871 |
| Molecular Formula | C17H15FN2O4 |
| Molecular Weight | 330.32 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | 2-(N-acetyl-2-fluoroanilino)-N-(1,3-benzodioxol-5-yl)acetamide |
| SMILES | CC(=O)N(CC(=O)Nc1ccc2c(c1)OCO2)c1ccccc1F |
| InChI | InChI=1S/C17H15FN2O4/c1-11(21)20(14-5-3-2-4-13(14)18)9-17(22)19-12-6-7-15-16(8-12)24-10-23-15/h2-8H,9-10H2,1H3,(H,19,22) |
| InChIKey | GZLCTHHXMPRQAZ-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.32 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |