C15H10Cl2N2O4 — CID 108531049
N-(1,3-benzodioxol-5-yl)-N'-(3,5-dichlorophenyl)oxamide (PubChem CID 108531049) has the molecular formula C15H10Cl2N2O4 and a molecular weight of 353.16 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-yl)-N'-(3,5-dichlorophenyl)oxamide.
| Compound Name | N-(1,3-benzodioxol-5-yl)-N'-(3,5-dichlorophenyl)oxamide |
|---|---|
| PubChem CID | 108531049 |
| Molecular Formula | C15H10Cl2N2O4 |
| Molecular Weight | 353.16 g/mol |
| Exact Mass | 352.00 |
| IUPAC Name | N-(1,3-benzodioxol-5-yl)-N'-(3,5-dichlorophenyl)oxamide |
| SMILES | O=C(Nc1cc(Cl)cc(Cl)c1)C(=O)Nc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H10Cl2N2O4/c16-8-3-9(17)5-11(4-8)19-15(21)14(20)18-10-1-2-12-13(6-10)23-7-22-12/h1-6H,7H2,(H,18,20)(H,19,21) |
| InChIKey | FNWXRBKRCSHTGH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.16 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|