C21H20N2O4 — CID 126418545
2-(1,3-benzodioxol-5-yloxy)-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetamide (PubChem CID 126418545) has the molecular formula C21H20N2O4 and a molecular weight of 364.40 g/mol. Its IUPAC name is 2-(1,3-benzodioxol-5-yloxy)-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetamide.
| Compound Name | 2-(1,3-benzodioxol-5-yloxy)-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetamide |
|---|---|
| PubChem CID | 126418545 |
| Molecular Formula | C21H20N2O4 |
| Molecular Weight | 364.40 g/mol |
| Exact Mass | 364.14 |
| IUPAC Name | 2-(1,3-benzodioxol-5-yloxy)-N-[(1R)-2,3,4,9-tetrahydro-1H-carbazol-1-yl]acetamide |
| SMILES | O=C(COc1ccc2c(c1)OCO2)N[C@@H]1CCCc2c1[nH]c1ccccc21 |
| InChI | InChI=1S/C21H20N2O4/c24-20(11-25-13-8-9-18-19(10-13)27-12-26-18)22-17-7-3-5-15-14-4-1-2-6-16(14)23-21(15)17/h1-2,4,6,8-10,17,23H,3,5,7,11-12H2,(H,22,24)/t17-/m1/s1 |
| InChIKey | ROOHXRKRDKIZOM-QGZVFWFLSA-N |
| XLogP | 3.47 |
| TPSA | 72.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.40 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|