C20H21ClN2O2 — CID 11337242
N-(1,3-benzodioxol-5-ylmethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine;hydrochloride (PubChem CID 11337242) has the molecular formula C20H21ClN2O2 and a molecular weight of 356.85 g/mol. Its IUPAC name is N-(1,3-benzodioxol-5-ylmethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine;hydrochloride.
| Compound Name | N-(1,3-benzodioxol-5-ylmethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine;hydrochloride |
|---|---|
| PubChem CID | 11337242 |
| Molecular Formula | C20H21ClN2O2 |
| Molecular Weight | 356.85 g/mol |
| Exact Mass | 356.13 |
| IUPAC Name | N-(1,3-benzodioxol-5-ylmethyl)-2,3,4,9-tetrahydro-1H-carbazol-1-amine;hydrochloride |
| SMILES | Cl.c1ccc2c3c([nH]c2c1)C(NCc1ccc2c(c1)OCO2)CCC3 |
| InChI | InChI=1S/C20H20N2O2.ClH/c1-2-6-16-14(4-1)15-5-3-7-17(20(15)22-16)21-11-13-8-9-18-19(10-13)24-12-23-18;/h1-2,4,6,8-10,17,21-22H,3,5,7,11-12H2;1H |
| InChIKey | WDDWZPKSMMAEPB-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 46.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.85 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|