C27H23N3O4S — CID 58717168
(1R)-1-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide (PubChem CID 58717168) has the molecular formula C27H23N3O4S and a molecular weight of 485.57 g/mol. Its IUPAC name is (1R)-1-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide.
| Compound Name | (1R)-1-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
|---|---|
| PubChem CID | 58717168 |
| Molecular Formula | C27H23N3O4S |
| Molecular Weight | 485.57 g/mol |
| Exact Mass | 485.14 |
| IUPAC Name | (1R)-1-(1,3-benzodioxol-5-yl)-N-(1,3-benzodioxol-5-ylmethyl)-1,3,4,9-tetrahydropyrido[3,4-b]indole-2-carbothioamide |
| SMILES | S=C(NCc1ccc2c(c1)OCO2)N1CCc2c([nH]c3ccccc23)[C@H]1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C27H23N3O4S/c35-27(28-13-16-5-7-21-23(11-16)33-14-31-21)30-10-9-19-18-3-1-2-4-20(18)29-25(19)26(30)17-6-8-22-24(12-17)34-15-32-22/h1-8,11-12,26,29H,9-10,13-15H2,(H,28,35)/t26-/m1/s1 |
| InChIKey | FFVICMNTEJOTOD-AREMUKBSSA-N |
| XLogP | 4.65 |
| TPSA | 67.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.57 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|