C28H22N2O3S — CID 10226867
1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1-benzothiophen-3-yl)ethanone (PubChem CID 10226867) has the molecular formula C28H22N2O3S and a molecular weight of 466.56 g/mol. Its IUPAC name is 1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1-benzothiophen-3-yl)ethanone.
| Compound Name | 1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1-benzothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 10226867 |
| Molecular Formula | C28H22N2O3S |
| Molecular Weight | 466.56 g/mol |
| Exact Mass | 466.14 |
| IUPAC Name | 1-[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-2-(1-benzothiophen-3-yl)ethanone |
| SMILES | O=C(Cc1csc2ccccc12)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C28H22N2O3S/c31-26(14-18-15-34-25-8-4-2-5-19(18)25)30-12-11-21-20-6-1-3-7-22(20)29-27(21)28(30)17-9-10-23-24(13-17)33-16-32-23/h1-10,13,15,28-29H,11-12,14,16H2 |
| InChIKey | CNBDWMABOFTNJD-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|