C23H18N2O4 — CID 3873357
[1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(furan-2-yl)methanone (PubChem CID 3873357) has the molecular formula C23H18N2O4 and a molecular weight of 386.41 g/mol. Its IUPAC name is [1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(furan-2-yl)methanone.
| Compound Name | [1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(furan-2-yl)methanone |
|---|---|
| PubChem CID | 3873357 |
| Molecular Formula | C23H18N2O4 |
| Molecular Weight | 386.41 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | [1-(1,3-benzodioxol-5-yl)-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl]-(furan-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCc2c([nH]c3ccccc23)C1c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C23H18N2O4/c26-23(19-6-3-11-27-19)25-10-9-16-15-4-1-2-5-17(15)24-21(16)22(25)14-7-8-18-20(12-14)29-13-28-18/h1-8,11-12,22,24H,9-10,13H2 |
| InChIKey | GGAATWIJQNYUBI-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 67.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.41 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|