C21H17N3O2 — CID 46359951
furan-2-yl-(1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone (PubChem CID 46359951) has the molecular formula C21H17N3O2 and a molecular weight of 343.39 g/mol. Its IUPAC name is furan-2-yl-(1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone.
| Compound Name | furan-2-yl-(1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
|---|---|
| PubChem CID | 46359951 |
| Molecular Formula | C21H17N3O2 |
| Molecular Weight | 343.39 g/mol |
| Exact Mass | 343.13 |
| IUPAC Name | furan-2-yl-(1-pyridin-3-yl-1,3,4,9-tetrahydropyrido[3,4-b]indol-2-yl)methanone |
| SMILES | O=C(c1ccco1)N1CCc2c([nH]c3ccccc23)C1c1cccnc1 |
| InChI | InChI=1S/C21H17N3O2/c25-21(18-8-4-12-26-18)24-11-9-16-15-6-1-2-7-17(15)23-19(16)20(24)14-5-3-10-22-13-14/h1-8,10,12-13,20,23H,9,11H2 |
| InChIKey | MLEOJFJBUUZKRY-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.39 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|